About tributyl-(2,4-dichlorophenoxy)stannane
tributyl-(2,4-dichlorophenoxy)stannane (PubChem CID 16683287) has the molecular formula C18H30Cl2OSn
and a molecular weight of 452.05 g/mol. Its IUPAC name is tributyl-(2,4-dichlorophenoxy)stannane.
Molecular Properties
| Compound Name | tributyl-(2,4-dichlorophenoxy)stannane |
| PubChem CID | 16683287 |
| Molecular Formula | C18H30Cl2OSn |
| Molecular Weight | 452.05 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | tributyl-(2,4-dichlorophenoxy)stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C6H4Cl2O.3C4H9.Sn/c7-4-1-2-6(9)5(8)3-4;3*1-3-4-2;/h1-3,9H;3*1,3-4H2,2H3;/q;;;;+1/p-1 |
| InChIKey | FFQFQPHOBAMGEV-UHFFFAOYSA-M |
| XLogP | 7.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.05 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze tributyl-(2,4-dichlorophenoxy)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-(2,4-dichlorophenoxy)stannane?
The IUPAC name of tributyl-(2,4-dichlorophenoxy)stannane (CID 16683287) is tributyl-(2,4-dichlorophenoxy)stannane.
What is the SMILES notation for tributyl-(2,4-dichlorophenoxy)stannane?
The canonical SMILES for tributyl-(2,4-dichlorophenoxy)stannane is CCCC[Sn](CCCC)(CCCC)Oc1ccc(Cl)cc1Cl.
What is the InChIKey of tributyl-(2,4-dichlorophenoxy)stannane?
The InChIKey is FFQFQPHOBAMGEV-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H4Cl2O.3C4H9.Sn/c7-4-1-2-6(9)5(8)3-4;3*1-3-4-2;/h1-3,9H;3*1,3-4H2,2H3;/q;;;;+1/p-1.
What are the key properties of tributyl-(2,4-dichlorophenoxy)stannane?
tributyl-(2,4-dichlorophenoxy)stannane has a molecular weight of 452.05 g/mol, XLogP of 7.72, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-(2,4-dichlorophenoxy)stannane is sourced from PubChem (CID 16683287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).