About 3-(5-ethyl-1,2-thiazol-3-yl)-3-hydroxy-2-iminopropanimidoyl iodide
3-(5-ethyl-1,2-thiazol-3-yl)-3-hydroxy-2-iminopropanimidoyl iodide (PubChem CID 166833323) has the molecular formula C8H10IN3OS
and a molecular weight of 323.16 g/mol. Its IUPAC name is 3-(5-ethyl-1,2-thiazol-3-yl)-3-hydroxy-2-iminopropanimidoyl iodide.
Molecular Properties
| Compound Name | 3-(5-ethyl-1,2-thiazol-3-yl)-3-hydroxy-2-iminopropanimidoyl iodide |
| PubChem CID | 166833323 |
| Molecular Formula | C8H10IN3OS |
| Molecular Weight | 323.16 g/mol |
| Exact Mass | 322.96 |
| IUPAC Name | 3-(5-ethyl-1,2-thiazol-3-yl)-3-hydroxy-2-iminopropanimidoyl iodide |
| SMILES | [H]/N=C(I)/C(=N\[H])C(O)c1cc(CC)sn1 |
| InChI | InChI=1S/C8H10IN3OS/c1-2-4-3-5(12-14-4)7(13)6(10)8(9)11/h3,7,10-11,13H,2H2,1H3/b10-6-,11-8- |
| InChIKey | AXCHFMUXYHXZIN-XNFNPUBGSA-N |
| XLogP | 2.17 |
| TPSA | 80.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.16 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-ethyl-1,2-thiazol-3-yl)-3-hydroxy-2-iminopropanimidoyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-ethyl-1,2-thiazol-3-yl)-3-hydroxy-2-iminopropanimidoyl iodide?
The IUPAC name of 3-(5-ethyl-1,2-thiazol-3-yl)-3-hydroxy-2-iminopropanimidoyl iodide (CID 166833323) is 3-(5-ethyl-1,2-thiazol-3-yl)-3-hydroxy-2-iminopropanimidoyl iodide.
What is the SMILES notation for 3-(5-ethyl-1,2-thiazol-3-yl)-3-hydroxy-2-iminopropanimidoyl iodide?
The canonical SMILES for 3-(5-ethyl-1,2-thiazol-3-yl)-3-hydroxy-2-iminopropanimidoyl iodide is [H]/N=C(I)/C(=N\[H])C(O)c1cc(CC)sn1.
What is the InChIKey of 3-(5-ethyl-1,2-thiazol-3-yl)-3-hydroxy-2-iminopropanimidoyl iodide?
The InChIKey is AXCHFMUXYHXZIN-XNFNPUBGSA-N. The full InChI is InChI=1S/C8H10IN3OS/c1-2-4-3-5(12-14-4)7(13)6(10)8(9)11/h3,7,10-11,13H,2H2,1H3/b10-6-,11-8-.
What are the key properties of 3-(5-ethyl-1,2-thiazol-3-yl)-3-hydroxy-2-iminopropanimidoyl iodide?
3-(5-ethyl-1,2-thiazol-3-yl)-3-hydroxy-2-iminopropanimidoyl iodide has a molecular weight of 323.16 g/mol, XLogP of 2.17, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-ethyl-1,2-thiazol-3-yl)-3-hydroxy-2-iminopropanimidoyl iodide is sourced from PubChem (CID 166833323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).