C12H21NO — CID 166833364
(3Z,5Z)-N-(methoxymethyl)-3,5-dimethyl-2-methylidenehepta-3,5-dien-1-amine (PubChem CID 166833364) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (3Z,5Z)-N-(methoxymethyl)-3,5-dimethyl-2-methylidenehepta-3,5-dien-1-amine.
| Compound Name | (3Z,5Z)-N-(methoxymethyl)-3,5-dimethyl-2-methylidenehepta-3,5-dien-1-amine |
|---|---|
| PubChem CID | 166833364 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (3Z,5Z)-N-(methoxymethyl)-3,5-dimethyl-2-methylidenehepta-3,5-dien-1-amine |
| SMILES | C=C(CNCOC)/C(C)=C\C(C)=C/C |
| InChI | InChI=1S/C12H21NO/c1-6-10(2)7-11(3)12(4)8-13-9-14-5/h6-7,13H,4,8-9H2,1-3,5H3/b10-6-,11-7- |
| InChIKey | HJWYZDHVVAGIGY-SQXCDDPUSA-N |
| XLogP | 2.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|