About [(Z)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]hydrazine
[(Z)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]hydrazine (PubChem CID 166833684) has the molecular formula C8H14F2N2
and a molecular weight of 176.21 g/mol. Its IUPAC name is [(Z)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]hydrazine.
Molecular Properties
| Compound Name | [(Z)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]hydrazine |
| PubChem CID | 166833684 |
| Molecular Formula | C8H14F2N2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | [(Z)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]hydrazine |
| SMILES | C=C(/C=C(/C)CNN)C(C)(F)F |
| InChI | InChI=1S/C8H14F2N2/c1-6(5-12-11)4-7(2)8(3,9)10/h4,12H,2,5,11H2,1,3H3/b6-4- |
| InChIKey | DJFALPJLOGSVHL-XQRVVYSFSA-N |
| XLogP | 1.61 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]hydrazine?
The IUPAC name of [(Z)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]hydrazine (CID 166833684) is [(Z)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]hydrazine.
What is the SMILES notation for [(Z)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]hydrazine?
The canonical SMILES for [(Z)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]hydrazine is C=C(/C=C(/C)CNN)C(C)(F)F.
What is the InChIKey of [(Z)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]hydrazine?
The InChIKey is DJFALPJLOGSVHL-XQRVVYSFSA-N. The full InChI is InChI=1S/C8H14F2N2/c1-6(5-12-11)4-7(2)8(3,9)10/h4,12H,2,5,11H2,1,3H3/b6-4-.
What are the key properties of [(Z)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]hydrazine?
[(Z)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]hydrazine has a molecular weight of 176.21 g/mol, XLogP of 1.61, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]hydrazine is sourced from PubChem (CID 166833684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).