C14H15Cl4NO2Pb — CID 16683433
4,5,6,7-tetrachloro-2-triethylplumbylisoindole-1,3-dione (PubChem CID 16683433) has the molecular formula C14H15Cl4NO2Pb and a molecular weight of 578.29 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-triethylplumbylisoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrachloro-2-triethylplumbylisoindole-1,3-dione |
|---|---|
| PubChem CID | 16683433 |
| Molecular Formula | C14H15Cl4NO2Pb |
| Molecular Weight | 578.29 g/mol |
| Exact Mass | 576.96 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-triethylplumbylisoindole-1,3-dione |
| SMILES | CC[Pb](CC)(CC)N1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C8HCl4NO2.3C2H5.Pb/c9-3-1-2(8(15)13-7(1)14)4(10)6(12)5(3)11;3*1-2;/h(H,13,14,15);3*1H2,2H3;/q;;;;+1/p-1 |
| InChIKey | XUXGRXGVJMDOCG-UHFFFAOYSA-M |
| XLogP | 5.90 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.29 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|