C18H27F3N2 — CID 166834486
1-[[1-[(3Z,5Z)-4-(trifluoromethyl)hepta-1,3,5-trien-3-yl]pyrrolidin-3-yl]methyl]piperidine (PubChem CID 166834486) has the molecular formula C18H27F3N2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 1-[[1-[(3Z,5Z)-4-(trifluoromethyl)hepta-1,3,5-trien-3-yl]pyrrolidin-3-yl]methyl]piperidine.
| Compound Name | 1-[[1-[(3Z,5Z)-4-(trifluoromethyl)hepta-1,3,5-trien-3-yl]pyrrolidin-3-yl]methyl]piperidine |
|---|---|
| PubChem CID | 166834486 |
| Molecular Formula | C18H27F3N2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | 1-[[1-[(3Z,5Z)-4-(trifluoromethyl)hepta-1,3,5-trien-3-yl]pyrrolidin-3-yl]methyl]piperidine |
| SMILES | C=C/C(=C(\C=C/C)C(F)(F)F)N1CCC(CN2CCCCC2)C1 |
| InChI | InChI=1S/C18H27F3N2/c1-3-8-16(18(19,20)21)17(4-2)23-12-9-15(14-23)13-22-10-6-5-7-11-22/h3-4,8,15H,2,5-7,9-14H2,1H3/b8-3-,17-16- |
| InChIKey | NFPHPVGZGWEMFM-RHMAYXBSSA-N |
| XLogP | 4.37 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|