About 3-heptan-3-yl-2,4-dimethyl-1,3-dihydropyrazole
3-heptan-3-yl-2,4-dimethyl-1,3-dihydropyrazole (PubChem CID 166834566) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is 3-heptan-3-yl-2,4-dimethyl-1,3-dihydropyrazole.
Molecular Properties
| Compound Name | 3-heptan-3-yl-2,4-dimethyl-1,3-dihydropyrazole |
| PubChem CID | 166834566 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 3-heptan-3-yl-2,4-dimethyl-1,3-dihydropyrazole |
| SMILES | CCCCC(CC)C1C(C)=CNN1C |
| InChI | InChI=1S/C12H24N2/c1-5-7-8-11(6-2)12-10(3)9-13-14(12)4/h9,11-13H,5-8H2,1-4H3 |
| InChIKey | KVZWIHGZNSMDSJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-heptan-3-yl-2,4-dimethyl-1,3-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-heptan-3-yl-2,4-dimethyl-1,3-dihydropyrazole?
The IUPAC name of 3-heptan-3-yl-2,4-dimethyl-1,3-dihydropyrazole (CID 166834566) is 3-heptan-3-yl-2,4-dimethyl-1,3-dihydropyrazole.
What is the SMILES notation for 3-heptan-3-yl-2,4-dimethyl-1,3-dihydropyrazole?
The canonical SMILES for 3-heptan-3-yl-2,4-dimethyl-1,3-dihydropyrazole is CCCCC(CC)C1C(C)=CNN1C.
What is the InChIKey of 3-heptan-3-yl-2,4-dimethyl-1,3-dihydropyrazole?
The InChIKey is KVZWIHGZNSMDSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2/c1-5-7-8-11(6-2)12-10(3)9-13-14(12)4/h9,11-13H,5-8H2,1-4H3.
What are the key properties of 3-heptan-3-yl-2,4-dimethyl-1,3-dihydropyrazole?
3-heptan-3-yl-2,4-dimethyl-1,3-dihydropyrazole has a molecular weight of 196.34 g/mol, XLogP of 2.93, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-heptan-3-yl-2,4-dimethyl-1,3-dihydropyrazole is sourced from PubChem (CID 166834566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).