About (3Z)-3-[difluoro(phosphanyl)methyl]hexa-1,3,5-triene-2-thiol
(3Z)-3-[difluoro(phosphanyl)methyl]hexa-1,3,5-triene-2-thiol (PubChem CID 166834645) has the molecular formula C7H9F2PS
and a molecular weight of 194.19 g/mol. Its IUPAC name is (3Z)-3-[difluoro(phosphanyl)methyl]hexa-1,3,5-triene-2-thiol.
Molecular Properties
| Compound Name | (3Z)-3-[difluoro(phosphanyl)methyl]hexa-1,3,5-triene-2-thiol |
| PubChem CID | 166834645 |
| Molecular Formula | C7H9F2PS |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | (3Z)-3-[difluoro(phosphanyl)methyl]hexa-1,3,5-triene-2-thiol |
| SMILES | C=C/C=C(\C(=C)S)C(F)(F)P |
| InChI | InChI=1S/C7H9F2PS/c1-3-4-6(5(2)11)7(8,9)10/h3-4,11H,1-2,10H2/b6-4+ |
| InChIKey | GORHJYIYKPAMRV-GQCTYLIASA-N |
| XLogP | 3.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-[difluoro(phosphanyl)methyl]hexa-1,3,5-triene-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-[difluoro(phosphanyl)methyl]hexa-1,3,5-triene-2-thiol?
The IUPAC name of (3Z)-3-[difluoro(phosphanyl)methyl]hexa-1,3,5-triene-2-thiol (CID 166834645) is (3Z)-3-[difluoro(phosphanyl)methyl]hexa-1,3,5-triene-2-thiol.
What is the SMILES notation for (3Z)-3-[difluoro(phosphanyl)methyl]hexa-1,3,5-triene-2-thiol?
The canonical SMILES for (3Z)-3-[difluoro(phosphanyl)methyl]hexa-1,3,5-triene-2-thiol is C=C/C=C(\C(=C)S)C(F)(F)P.
What is the InChIKey of (3Z)-3-[difluoro(phosphanyl)methyl]hexa-1,3,5-triene-2-thiol?
The InChIKey is GORHJYIYKPAMRV-GQCTYLIASA-N. The full InChI is InChI=1S/C7H9F2PS/c1-3-4-6(5(2)11)7(8,9)10/h3-4,11H,1-2,10H2/b6-4+.
What are the key properties of (3Z)-3-[difluoro(phosphanyl)methyl]hexa-1,3,5-triene-2-thiol?
(3Z)-3-[difluoro(phosphanyl)methyl]hexa-1,3,5-triene-2-thiol has a molecular weight of 194.19 g/mol, XLogP of 3.01, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-[difluoro(phosphanyl)methyl]hexa-1,3,5-triene-2-thiol is sourced from PubChem (CID 166834645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).