C27H33N3O3 — CID 166835574
6-butoxy-N-formyl-N,2-dimethyl-9-[(4-methylphenyl)methyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-4-carboxamide (PubChem CID 166835574) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is 6-butoxy-N-formyl-N,2-dimethyl-9-[(4-methylphenyl)methyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-4-carboxamide.
| Compound Name | 6-butoxy-N-formyl-N,2-dimethyl-9-[(4-methylphenyl)methyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-4-carboxamide |
|---|---|
| PubChem CID | 166835574 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 6-butoxy-N-formyl-N,2-dimethyl-9-[(4-methylphenyl)methyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-4-carboxamide |
| SMILES | CCCCOc1ccc2c(c1)c1c(n2Cc2ccc(C)cc2)CN(C)CC1C(=O)N(C)C=O |
| InChI | InChI=1S/C27H33N3O3/c1-5-6-13-33-21-11-12-24-22(14-21)26-23(27(32)29(4)18-31)16-28(3)17-25(26)30(24)15-20-9-7-19(2)8-10-20/h7-12,14,18,23H,5-6,13,15-17H2,1-4H3 |
| InChIKey | SQAKKMIBCHJRSQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|