About tris[(5-chloro-2-pyridinyl)oxy]indigane;hydrochloride
tris[(5-chloro-2-pyridinyl)oxy]indigane;hydrochloride (PubChem CID 16683561) has the molecular formula C15H10Cl4InN3O3
and a molecular weight of 536.89 g/mol. Its IUPAC name is tris[(5-chloro-2-pyridinyl)oxy]indigane;hydrochloride.
Molecular Properties
| Compound Name | tris[(5-chloro-2-pyridinyl)oxy]indigane;hydrochloride |
| PubChem CID | 16683561 |
| Molecular Formula | C15H10Cl4InN3O3 |
| Molecular Weight | 536.89 g/mol |
| Exact Mass | 534.85 |
| IUPAC Name | tris[(5-chloro-2-pyridinyl)oxy]indigane;hydrochloride |
| SMILES | Cl.Clc1ccc(O[In](Oc2ccc(Cl)cn2)Oc2ccc(Cl)cn2)nc1 |
| InChI | InChI=1S/3C5H4ClNO.ClH.In/c3*6-4-1-2-5(8)7-3-4;;/h3*1-3H,(H,7,8);1H;/q;;;;+3/p-3 |
| InChIKey | YFCMUPBQLWLGFC-UHFFFAOYSA-K |
| XLogP | 4.78 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 536.89 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tris[(5-chloro-2-pyridinyl)oxy]indigane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris[(5-chloro-2-pyridinyl)oxy]indigane;hydrochloride?
The IUPAC name of tris[(5-chloro-2-pyridinyl)oxy]indigane;hydrochloride (CID 16683561) is tris[(5-chloro-2-pyridinyl)oxy]indigane;hydrochloride.
What is the SMILES notation for tris[(5-chloro-2-pyridinyl)oxy]indigane;hydrochloride?
The canonical SMILES for tris[(5-chloro-2-pyridinyl)oxy]indigane;hydrochloride is Cl.Clc1ccc(O[In](Oc2ccc(Cl)cn2)Oc2ccc(Cl)cn2)nc1.
What is the InChIKey of tris[(5-chloro-2-pyridinyl)oxy]indigane;hydrochloride?
The InChIKey is YFCMUPBQLWLGFC-UHFFFAOYSA-K. The full InChI is InChI=1S/3C5H4ClNO.ClH.In/c3*6-4-1-2-5(8)7-3-4;;/h3*1-3H,(H,7,8);1H;/q;;;;+3/p-3.
What are the key properties of tris[(5-chloro-2-pyridinyl)oxy]indigane;hydrochloride?
tris[(5-chloro-2-pyridinyl)oxy]indigane;hydrochloride has a molecular weight of 536.89 g/mol, XLogP of 4.78, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tris[(5-chloro-2-pyridinyl)oxy]indigane;hydrochloride is sourced from PubChem (CID 16683561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).