About [dibutyl-(2,3-difluorobenzoyl)oxystannyl] 2,3-difluorobenzoate
[dibutyl-(2,3-difluorobenzoyl)oxystannyl] 2,3-difluorobenzoate (PubChem CID 16683576) has the molecular formula C22H24F4O4Sn
and a molecular weight of 547.13 g/mol. Its IUPAC name is [dibutyl-(2,3-difluorobenzoyl)oxystannyl] 2,3-difluorobenzoate.
Molecular Properties
| Compound Name | [dibutyl-(2,3-difluorobenzoyl)oxystannyl] 2,3-difluorobenzoate |
| PubChem CID | 16683576 |
| Molecular Formula | C22H24F4O4Sn |
| Molecular Weight | 547.13 g/mol |
| Exact Mass | 548.06 |
| IUPAC Name | [dibutyl-(2,3-difluorobenzoyl)oxystannyl] 2,3-difluorobenzoate |
| SMILES | CCCC[Sn](CCCC)(OC(=O)c1cccc(F)c1F)OC(=O)c1cccc(F)c1F |
| InChI | InChI=1S/2C7H4F2O2.2C4H9.Sn/c2*8-5-3-1-2-4(6(5)9)7(10)11;2*1-3-4-2;/h2*1-3H,(H,10,11);2*1,3-4H2,2H3;/q;;;;+2/p-2 |
| InChIKey | NJRFRYBNPJGKEI-UHFFFAOYSA-L |
| XLogP | 6.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 547.13 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [dibutyl-(2,3-difluorobenzoyl)oxystannyl] 2,3-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dibutyl-(2,3-difluorobenzoyl)oxystannyl] 2,3-difluorobenzoate?
The IUPAC name of [dibutyl-(2,3-difluorobenzoyl)oxystannyl] 2,3-difluorobenzoate (CID 16683576) is [dibutyl-(2,3-difluorobenzoyl)oxystannyl] 2,3-difluorobenzoate.
What is the SMILES notation for [dibutyl-(2,3-difluorobenzoyl)oxystannyl] 2,3-difluorobenzoate?
The canonical SMILES for [dibutyl-(2,3-difluorobenzoyl)oxystannyl] 2,3-difluorobenzoate is CCCC[Sn](CCCC)(OC(=O)c1cccc(F)c1F)OC(=O)c1cccc(F)c1F.
What is the InChIKey of [dibutyl-(2,3-difluorobenzoyl)oxystannyl] 2,3-difluorobenzoate?
The InChIKey is NJRFRYBNPJGKEI-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H4F2O2.2C4H9.Sn/c2*8-5-3-1-2-4(6(5)9)7(10)11;2*1-3-4-2;/h2*1-3H,(H,10,11);2*1,3-4H2,2H3;/q;;;;+2/p-2.
What are the key properties of [dibutyl-(2,3-difluorobenzoyl)oxystannyl] 2,3-difluorobenzoate?
[dibutyl-(2,3-difluorobenzoyl)oxystannyl] 2,3-difluorobenzoate has a molecular weight of 547.13 g/mol, XLogP of 6.30, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [dibutyl-(2,3-difluorobenzoyl)oxystannyl] 2,3-difluorobenzoate is sourced from PubChem (CID 16683576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).