C18H18N4O3 — CID 166835853
13-methyl-8,14-dioxa-10,19,20,23-tetrazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2,4,6(23),15(22),16,18(21)-heptaen-9-one (PubChem CID 166835853) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is 13-methyl-8,14-dioxa-10,19,20,23-tetrazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2,4,6(23),15(22),16,18(21)-heptaen-9-one.
| Compound Name | 13-methyl-8,14-dioxa-10,19,20,23-tetrazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2,4,6(23),15(22),16,18(21)-heptaen-9-one |
|---|---|
| PubChem CID | 166835853 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 13-methyl-8,14-dioxa-10,19,20,23-tetrazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2,4,6(23),15(22),16,18(21)-heptaen-9-one |
| SMILES | CC1CCNC(=O)OCc2cccc(n2)-c2n[nH]c3ccc(cc23)O1 |
| InChI | InChI=1S/C18H18N4O3/c1-11-7-8-19-18(23)24-10-12-3-2-4-16(20-12)17-14-9-13(25-11)5-6-15(14)21-22-17/h2-6,9,11H,7-8,10H2,1H3,(H,19,23)(H,21,22) |
| InChIKey | RRSVSWNSAGSTMT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |