C19H20N4O4 — CID 166835878
(13R)-5-methoxy-13-methyl-8,14-dioxa-4,10,19,20-tetrazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2(23),3,5,15(22),16,18(21)-heptaen-9-one (PubChem CID 166835878) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is (13R)-5-methoxy-13-methyl-8,14-dioxa-4,10,19,20-tetrazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2(23),3,5,15(22),16,18(21)-heptaen-9-one.
| Compound Name | (13R)-5-methoxy-13-methyl-8,14-dioxa-4,10,19,20-tetrazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2(23),3,5,15(22),16,18(21)-heptaen-9-one |
|---|---|
| PubChem CID | 166835878 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | (13R)-5-methoxy-13-methyl-8,14-dioxa-4,10,19,20-tetrazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2(23),3,5,15(22),16,18(21)-heptaen-9-one |
| SMILES | COc1ncc2cc1COC(=O)NCC[C@@H](C)Oc1ccc3[nH]nc-2c3c1 |
| InChI | InChI=1S/C19H20N4O4/c1-11-5-6-20-19(24)26-10-13-7-12(9-21-18(13)25-2)17-15-8-14(27-11)3-4-16(15)22-23-17/h3-4,7-9,11H,5-6,10H2,1-2H3,(H,20,24)(H,22,23)/t11-/m1/s1 |
| InChIKey | AAQDOKKMMITMAY-LLVKDONJSA-N |
| XLogP | 3.03 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |