About acetyloxy-[4-(acetyloxymercurio)-2,3-dimethoxybutyl]mercury
acetyloxy-[4-(acetyloxymercurio)-2,3-dimethoxybutyl]mercury (PubChem CID 16683593) has the molecular formula C10H18Hg2O6
and a molecular weight of 635.43 g/mol. Its IUPAC name is acetyloxy-[4-(acetyloxymercurio)-2,3-dimethoxybutyl]mercury.
Molecular Properties
| Compound Name | acetyloxy-[4-(acetyloxymercurio)-2,3-dimethoxybutyl]mercury |
| PubChem CID | 16683593 |
| Molecular Formula | C10H18Hg2O6 |
| Molecular Weight | 635.43 g/mol |
| Exact Mass | 638.05 |
| IUPAC Name | acetyloxy-[4-(acetyloxymercurio)-2,3-dimethoxybutyl]mercury |
| SMILES | COC(C[Hg]OC(C)=O)C(C[Hg]OC(C)=O)OC |
| InChI | InChI=1S/C6H12O2.2C2H4O2.2Hg/c1-5(7-3)6(2)8-4;2*1-2(3)4;;/h5-6H,1-2H2,3-4H3;2*1H3,(H,3,4);;/q;;;2*+1/p-2 |
| InChIKey | VGWUFMWVHALSRK-UHFFFAOYSA-L |
| XLogP | 0.97 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 635.43 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze acetyloxy-[4-(acetyloxymercurio)-2,3-dimethoxybutyl]mercury with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyloxy-[4-(acetyloxymercurio)-2,3-dimethoxybutyl]mercury?
The IUPAC name of acetyloxy-[4-(acetyloxymercurio)-2,3-dimethoxybutyl]mercury (CID 16683593) is acetyloxy-[4-(acetyloxymercurio)-2,3-dimethoxybutyl]mercury.
What is the SMILES notation for acetyloxy-[4-(acetyloxymercurio)-2,3-dimethoxybutyl]mercury?
The canonical SMILES for acetyloxy-[4-(acetyloxymercurio)-2,3-dimethoxybutyl]mercury is COC(C[Hg]OC(C)=O)C(C[Hg]OC(C)=O)OC.
What is the InChIKey of acetyloxy-[4-(acetyloxymercurio)-2,3-dimethoxybutyl]mercury?
The InChIKey is VGWUFMWVHALSRK-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H12O2.2C2H4O2.2Hg/c1-5(7-3)6(2)8-4;2*1-2(3)4;;/h5-6H,1-2H2,3-4H3;2*1H3,(H,3,4);;/q;;;2*+1/p-2.
What are the key properties of acetyloxy-[4-(acetyloxymercurio)-2,3-dimethoxybutyl]mercury?
acetyloxy-[4-(acetyloxymercurio)-2,3-dimethoxybutyl]mercury has a molecular weight of 635.43 g/mol, XLogP of 0.97, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetyloxy-[4-(acetyloxymercurio)-2,3-dimethoxybutyl]mercury is sourced from PubChem (CID 16683593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).