C19H20N4O3 — CID 166835950
(7R,13R)-7,13-dimethyl-8,14-dioxa-10,19,20,23-tetrazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2(23),3,5,15(22),16,18(21)-heptaen-9-one (PubChem CID 166835950) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is (7R,13R)-7,13-dimethyl-8,14-dioxa-10,19,20,23-tetrazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2(23),3,5,15(22),16,18(21)-heptaen-9-one.
| Compound Name | (7R,13R)-7,13-dimethyl-8,14-dioxa-10,19,20,23-tetrazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2(23),3,5,15(22),16,18(21)-heptaen-9-one |
|---|---|
| PubChem CID | 166835950 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | (7R,13R)-7,13-dimethyl-8,14-dioxa-10,19,20,23-tetrazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2(23),3,5,15(22),16,18(21)-heptaen-9-one |
| SMILES | C[C@@H]1CCNC(=O)O[C@H](C)c2cccc(n2)-c2n[nH]c3ccc(cc23)O1 |
| InChI | InChI=1S/C19H20N4O3/c1-11-8-9-20-19(24)26-12(2)15-4-3-5-17(21-15)18-14-10-13(25-11)6-7-16(14)22-23-18/h3-7,10-12H,8-9H2,1-2H3,(H,20,24)(H,22,23)/t11-,12-/m1/s1 |
| InChIKey | WGRPSMWXPFQTSJ-VXGBXAGGSA-N |
| XLogP | 3.58 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |