About (Z)-2-[(3-ethyl-1,2-thiazol-5-yl)-hydroxymethyl]-3-(methylamino)prop-2-enimidoyl bromide
(Z)-2-[(3-ethyl-1,2-thiazol-5-yl)-hydroxymethyl]-3-(methylamino)prop-2-enimidoyl bromide (PubChem CID 166836556) has the molecular formula C10H14BrN3OS
and a molecular weight of 304.21 g/mol. Its IUPAC name is (Z)-2-[(3-ethyl-1,2-thiazol-5-yl)-hydroxymethyl]-3-(methylamino)prop-2-enimidoyl bromide.
Molecular Properties
| Compound Name | (Z)-2-[(3-ethyl-1,2-thiazol-5-yl)-hydroxymethyl]-3-(methylamino)prop-2-enimidoyl bromide |
| PubChem CID | 166836556 |
| Molecular Formula | C10H14BrN3OS |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | (Z)-2-[(3-ethyl-1,2-thiazol-5-yl)-hydroxymethyl]-3-(methylamino)prop-2-enimidoyl bromide |
| SMILES | [H]/N=C(Br)/C(=C\NC)C(O)c1cc(CC)ns1 |
| InChI | InChI=1S/C10H14BrN3OS/c1-3-6-4-8(16-14-6)9(15)7(5-13-2)10(11)12/h4-5,9,12-13,15H,3H2,1-2H3/b7-5-,12-10- |
| InChIKey | PEZIFBQYZCEQKM-PSVOIDRLSA-N |
| XLogP | 2.21 |
| TPSA | 69.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-[(3-ethyl-1,2-thiazol-5-yl)-hydroxymethyl]-3-(methylamino)prop-2-enimidoyl bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-[(3-ethyl-1,2-thiazol-5-yl)-hydroxymethyl]-3-(methylamino)prop-2-enimidoyl bromide?
The IUPAC name of (Z)-2-[(3-ethyl-1,2-thiazol-5-yl)-hydroxymethyl]-3-(methylamino)prop-2-enimidoyl bromide (CID 166836556) is (Z)-2-[(3-ethyl-1,2-thiazol-5-yl)-hydroxymethyl]-3-(methylamino)prop-2-enimidoyl bromide.
What is the SMILES notation for (Z)-2-[(3-ethyl-1,2-thiazol-5-yl)-hydroxymethyl]-3-(methylamino)prop-2-enimidoyl bromide?
The canonical SMILES for (Z)-2-[(3-ethyl-1,2-thiazol-5-yl)-hydroxymethyl]-3-(methylamino)prop-2-enimidoyl bromide is [H]/N=C(Br)/C(=C\NC)C(O)c1cc(CC)ns1.
What is the InChIKey of (Z)-2-[(3-ethyl-1,2-thiazol-5-yl)-hydroxymethyl]-3-(methylamino)prop-2-enimidoyl bromide?
The InChIKey is PEZIFBQYZCEQKM-PSVOIDRLSA-N. The full InChI is InChI=1S/C10H14BrN3OS/c1-3-6-4-8(16-14-6)9(15)7(5-13-2)10(11)12/h4-5,9,12-13,15H,3H2,1-2H3/b7-5-,12-10-.
What are the key properties of (Z)-2-[(3-ethyl-1,2-thiazol-5-yl)-hydroxymethyl]-3-(methylamino)prop-2-enimidoyl bromide?
(Z)-2-[(3-ethyl-1,2-thiazol-5-yl)-hydroxymethyl]-3-(methylamino)prop-2-enimidoyl bromide has a molecular weight of 304.21 g/mol, XLogP of 2.21, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-[(3-ethyl-1,2-thiazol-5-yl)-hydroxymethyl]-3-(methylamino)prop-2-enimidoyl bromide is sourced from PubChem (CID 166836556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).