C26H31FN6O — CID 166836636
(16R)-3-(cyclopropylmethyl)-13-fluoro-9-imino-5,16-dimethyl-8-(methylaminomethyl)-17-oxa-3,4,20-triazatetracyclo[16.3.1.02,6.010,15]docosa-1(22),2(6),4,10(15),11,13,18,20-octaen-19-amine (PubChem CID 166836636) has the molecular formula C26H31FN6O and a molecular weight of 462.57 g/mol. Its IUPAC name is (16R)-3-(cyclopropylmethyl)-13-fluoro-9-imino-5,16-dimethyl-8-(methylaminomethyl)-17-oxa-3,4,20-triazatetracyclo[16.3.1.02,6.010,15]docosa-1(22),2(6),4,10(15),11,13,18,20-octaen-19-amine.
| Compound Name | (16R)-3-(cyclopropylmethyl)-13-fluoro-9-imino-5,16-dimethyl-8-(methylaminomethyl)-17-oxa-3,4,20-triazatetracyclo[16.3.1.02,6.010,15]docosa-1(22),2(6),4,10(15),11,13,18,20-octaen-19-amine |
|---|---|
| PubChem CID | 166836636 |
| Molecular Formula | C26H31FN6O |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | (16R)-3-(cyclopropylmethyl)-13-fluoro-9-imino-5,16-dimethyl-8-(methylaminomethyl)-17-oxa-3,4,20-triazatetracyclo[16.3.1.02,6.010,15]docosa-1(22),2(6),4,10(15),11,13,18,20-octaen-19-amine |
| SMILES | [H]/N=C1/c2ccc(F)cc2[C@@H](C)Oc2cc(cnc2N)-c2c(c(C)nn2CC2CC2)CC1CNC |
| InChI | InChI=1S/C26H31FN6O/c1-14-21-8-17(11-30-3)24(28)20-7-6-19(27)10-22(20)15(2)34-23-9-18(12-31-26(23)29)25(21)33(32-14)13-16-4-5-16/h6-7,9-10,12,15-17,28,30H,4-5,8,11,13H2,1-3H3,(H2,29,31)/b28-24+/t15-,17?/m1/s1 |
| InChIKey | VUOUXTGPSXQMDT-GLACXSQXSA-N |
| XLogP | 4.28 |
| TPSA | 101.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|