C18H26N2 — CID 166837136
(1E,4Z)-4-methanimidoyl-2-methyl-1-(4-methyl-2-propan-2-ylphenyl)hexa-1,4-dien-1-amine (PubChem CID 166837136) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is (1E,4Z)-4-methanimidoyl-2-methyl-1-(4-methyl-2-propan-2-ylphenyl)hexa-1,4-dien-1-amine.
| Compound Name | (1E,4Z)-4-methanimidoyl-2-methyl-1-(4-methyl-2-propan-2-ylphenyl)hexa-1,4-dien-1-amine |
|---|---|
| PubChem CID | 166837136 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | (1E,4Z)-4-methanimidoyl-2-methyl-1-(4-methyl-2-propan-2-ylphenyl)hexa-1,4-dien-1-amine |
| SMILES | [H]/N=C/C(=C\C)C/C(C)=C(/N)c1ccc(C)cc1C(C)C |
| InChI | InChI=1S/C18H26N2/c1-6-15(11-19)10-14(5)18(20)16-8-7-13(4)9-17(16)12(2)3/h6-9,11-12,19H,10,20H2,1-5H3/b15-6-,18-14+,19-11+ |
| InChIKey | BIVFRAHZGYUZSM-DVEJSQFZSA-N |
| XLogP | 4.79 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|