About (Z)-2-[(3-cyano-1,2-oxazol-5-yl)methyl]-3-(methylamino)prop-2-enimidoyl bromide
(Z)-2-[(3-cyano-1,2-oxazol-5-yl)methyl]-3-(methylamino)prop-2-enimidoyl bromide (PubChem CID 166837223) has the molecular formula C9H9BrN4O
and a molecular weight of 269.10 g/mol. Its IUPAC name is (Z)-2-[(3-cyano-1,2-oxazol-5-yl)methyl]-3-(methylamino)prop-2-enimidoyl bromide.
Molecular Properties
| Compound Name | (Z)-2-[(3-cyano-1,2-oxazol-5-yl)methyl]-3-(methylamino)prop-2-enimidoyl bromide |
| PubChem CID | 166837223 |
| Molecular Formula | C9H9BrN4O |
| Molecular Weight | 269.10 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | (Z)-2-[(3-cyano-1,2-oxazol-5-yl)methyl]-3-(methylamino)prop-2-enimidoyl bromide |
| SMILES | [H]/N=C(Br)/C(=C\NC)Cc1cc(C#N)no1 |
| InChI | InChI=1S/C9H9BrN4O/c1-13-5-6(9(10)12)2-8-3-7(4-11)14-15-8/h3,5,12-13H,2H2,1H3/b6-5-,12-9- |
| InChIKey | JDDDMSQWYPOKJF-ZGCJARKRSA-N |
| XLogP | 1.56 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.10 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-[(3-cyano-1,2-oxazol-5-yl)methyl]-3-(methylamino)prop-2-enimidoyl bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-[(3-cyano-1,2-oxazol-5-yl)methyl]-3-(methylamino)prop-2-enimidoyl bromide?
The IUPAC name of (Z)-2-[(3-cyano-1,2-oxazol-5-yl)methyl]-3-(methylamino)prop-2-enimidoyl bromide (CID 166837223) is (Z)-2-[(3-cyano-1,2-oxazol-5-yl)methyl]-3-(methylamino)prop-2-enimidoyl bromide.
What is the SMILES notation for (Z)-2-[(3-cyano-1,2-oxazol-5-yl)methyl]-3-(methylamino)prop-2-enimidoyl bromide?
The canonical SMILES for (Z)-2-[(3-cyano-1,2-oxazol-5-yl)methyl]-3-(methylamino)prop-2-enimidoyl bromide is [H]/N=C(Br)/C(=C\NC)Cc1cc(C#N)no1.
What is the InChIKey of (Z)-2-[(3-cyano-1,2-oxazol-5-yl)methyl]-3-(methylamino)prop-2-enimidoyl bromide?
The InChIKey is JDDDMSQWYPOKJF-ZGCJARKRSA-N. The full InChI is InChI=1S/C9H9BrN4O/c1-13-5-6(9(10)12)2-8-3-7(4-11)14-15-8/h3,5,12-13H,2H2,1H3/b6-5-,12-9-.
What are the key properties of (Z)-2-[(3-cyano-1,2-oxazol-5-yl)methyl]-3-(methylamino)prop-2-enimidoyl bromide?
(Z)-2-[(3-cyano-1,2-oxazol-5-yl)methyl]-3-(methylamino)prop-2-enimidoyl bromide has a molecular weight of 269.10 g/mol, XLogP of 1.56, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-[(3-cyano-1,2-oxazol-5-yl)methyl]-3-(methylamino)prop-2-enimidoyl bromide is sourced from PubChem (CID 166837223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).