C23H17FN6O — CID 166837448
23-amino-17-fluoro-9-methyl-21-oxa-4,6,12,24-tetrazapentacyclo[20.3.1.02,6.08,13.014,19]hexacosa-1(26),2,4,8,10,12,14(19),15,17,22,24-undecaene-3-carbonitrile (PubChem CID 166837448) has the molecular formula C23H17FN6O and a molecular weight of 412.43 g/mol. Its IUPAC name is 23-amino-17-fluoro-9-methyl-21-oxa-4,6,12,24-tetrazapentacyclo[20.3.1.02,6.08,13.014,19]hexacosa-1(26),2,4,8,10,12,14(19),15,17,22,24-undecaene-3-carbonitrile.
| Compound Name | 23-amino-17-fluoro-9-methyl-21-oxa-4,6,12,24-tetrazapentacyclo[20.3.1.02,6.08,13.014,19]hexacosa-1(26),2,4,8,10,12,14(19),15,17,22,24-undecaene-3-carbonitrile |
|---|---|
| PubChem CID | 166837448 |
| Molecular Formula | C23H17FN6O |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 23-amino-17-fluoro-9-methyl-21-oxa-4,6,12,24-tetrazapentacyclo[20.3.1.02,6.08,13.014,19]hexacosa-1(26),2,4,8,10,12,14(19),15,17,22,24-undecaene-3-carbonitrile |
| SMILES | Cc1ccnc2c1Cn1cnc(C#N)c1-c1cnc(N)c(c1)OCc1cc(F)ccc1-2 |
| InChI | InChI=1S/C23H17FN6O/c1-13-4-5-27-21-17-3-2-16(24)6-15(17)11-31-20-7-14(9-28-23(20)26)22-19(8-25)29-12-30(22)10-18(13)21/h2-7,9,12H,10-11H2,1H3,(H2,26,28) |
| InChIKey | RSXBCOPPWNEFKH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 102.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|