About [1-benzyl-4-(4,4-dimethylpent-1-en-2-yl)piperazin-2-yl]methanol
[1-benzyl-4-(4,4-dimethylpent-1-en-2-yl)piperazin-2-yl]methanol (PubChem CID 166838025) has the molecular formula C19H30N2O
and a molecular weight of 302.46 g/mol. Its IUPAC name is [1-benzyl-4-(4,4-dimethylpent-1-en-2-yl)piperazin-2-yl]methanol.
Molecular Properties
| Compound Name | [1-benzyl-4-(4,4-dimethylpent-1-en-2-yl)piperazin-2-yl]methanol |
| PubChem CID | 166838025 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | [1-benzyl-4-(4,4-dimethylpent-1-en-2-yl)piperazin-2-yl]methanol |
| SMILES | C=C(CC(C)(C)C)N1CCN(Cc2ccccc2)C(CO)C1 |
| InChI | InChI=1S/C19H30N2O/c1-16(12-19(2,3)4)20-10-11-21(18(14-20)15-22)13-17-8-6-5-7-9-17/h5-9,18,22H,1,10-15H2,2-4H3 |
| InChIKey | ACDPPBPTORSGSM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-benzyl-4-(4,4-dimethylpent-1-en-2-yl)piperazin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-benzyl-4-(4,4-dimethylpent-1-en-2-yl)piperazin-2-yl]methanol?
The IUPAC name of [1-benzyl-4-(4,4-dimethylpent-1-en-2-yl)piperazin-2-yl]methanol (CID 166838025) is [1-benzyl-4-(4,4-dimethylpent-1-en-2-yl)piperazin-2-yl]methanol.
What is the SMILES notation for [1-benzyl-4-(4,4-dimethylpent-1-en-2-yl)piperazin-2-yl]methanol?
The canonical SMILES for [1-benzyl-4-(4,4-dimethylpent-1-en-2-yl)piperazin-2-yl]methanol is C=C(CC(C)(C)C)N1CCN(Cc2ccccc2)C(CO)C1.
What is the InChIKey of [1-benzyl-4-(4,4-dimethylpent-1-en-2-yl)piperazin-2-yl]methanol?
The InChIKey is ACDPPBPTORSGSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N2O/c1-16(12-19(2,3)4)20-10-11-21(18(14-20)15-22)13-17-8-6-5-7-9-17/h5-9,18,22H,1,10-15H2,2-4H3.
What are the key properties of [1-benzyl-4-(4,4-dimethylpent-1-en-2-yl)piperazin-2-yl]methanol?
[1-benzyl-4-(4,4-dimethylpent-1-en-2-yl)piperazin-2-yl]methanol has a molecular weight of 302.46 g/mol, XLogP of 3.12, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-benzyl-4-(4,4-dimethylpent-1-en-2-yl)piperazin-2-yl]methanol is sourced from PubChem (CID 166838025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).