C18H26O6Sn — CID 16683830
4,4-diethyl-7-methoxy-12-phenyl-3,5,8,11,13-pentaoxa-4-stannatricyclo[7.4.0.02,6]tridecane (PubChem CID 16683830) has the molecular formula C18H26O6Sn and a molecular weight of 457.11 g/mol. Its IUPAC name is 4,4-diethyl-7-methoxy-12-phenyl-3,5,8,11,13-pentaoxa-4-stannatricyclo[7.4.0.02,6]tridecane.
| Compound Name | 4,4-diethyl-7-methoxy-12-phenyl-3,5,8,11,13-pentaoxa-4-stannatricyclo[7.4.0.02,6]tridecane |
|---|---|
| PubChem CID | 16683830 |
| Molecular Formula | C18H26O6Sn |
| Molecular Weight | 457.11 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | 4,4-diethyl-7-methoxy-12-phenyl-3,5,8,11,13-pentaoxa-4-stannatricyclo[7.4.0.02,6]tridecane |
| SMILES | CC[Sn]1(CC)OC2C(OC)OC3COC(c4ccccc4)OC3C2O1 |
| InChI | InChI=1S/C14H16O6.2C2H5.Sn/c1-17-14-11(16)10(15)12-9(19-14)7-18-13(20-12)8-5-3-2-4-6-8;2*1-2;/h2-6,9-14H,7H2,1H3;2*1H2,2H3;/q-2;;;+2 |
| InChIKey | JYUHBAHJYLERDL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.11 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |