C25H42N6O7 — CID 166838439
tert-butyl 2-[(18S)-18-[3-(methylamino)propyl]-8,11,14,17,20-pentaoxo-7,10,13,16,19-pentazaspiro[5.14]icosan-12-yl]acetate (PubChem CID 166838439) has the molecular formula C25H42N6O7 and a molecular weight of 538.65 g/mol. Its IUPAC name is tert-butyl 2-[(18S)-18-[3-(methylamino)propyl]-8,11,14,17,20-pentaoxo-7,10,13,16,19-pentazaspiro[5.14]icosan-12-yl]acetate.
| Compound Name | tert-butyl 2-[(18S)-18-[3-(methylamino)propyl]-8,11,14,17,20-pentaoxo-7,10,13,16,19-pentazaspiro[5.14]icosan-12-yl]acetate |
|---|---|
| PubChem CID | 166838439 |
| Molecular Formula | C25H42N6O7 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.31 |
| IUPAC Name | tert-butyl 2-[(18S)-18-[3-(methylamino)propyl]-8,11,14,17,20-pentaoxo-7,10,13,16,19-pentazaspiro[5.14]icosan-12-yl]acetate |
| SMILES | CNCCC[C@@H]1NC(=O)C2(CCCCC2)NC(=O)CNC(=O)C(CC(=O)OC(C)(C)C)NC(=O)CNC1=O |
| InChI | InChI=1S/C25H42N6O7/c1-24(2,3)38-20(34)13-17-22(36)28-15-19(33)31-25(10-6-5-7-11-25)23(37)30-16(9-8-12-26-4)21(35)27-14-18(32)29-17/h16-17,26H,5-15H2,1-4H3,(H,27,35)(H,28,36)(H,29,32)(H,30,37)(H,31,33)/t16-,17?/m0/s1 |
| InChIKey | RYNAGHDGTSCKFL-BHWOMJMDSA-N |
| XLogP | -1.25 |
| TPSA | 183.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|