About 3,3-difluoro-1-(5-methylcyclohexa-1,5-dien-1-yl)pyrrolidine
3,3-difluoro-1-(5-methylcyclohexa-1,5-dien-1-yl)pyrrolidine (PubChem CID 166838445) has the molecular formula C11H15F2N
and a molecular weight of 199.24 g/mol. Its IUPAC name is 3,3-difluoro-1-(5-methylcyclohexa-1,5-dien-1-yl)pyrrolidine.
Molecular Properties
| Compound Name | 3,3-difluoro-1-(5-methylcyclohexa-1,5-dien-1-yl)pyrrolidine |
| PubChem CID | 166838445 |
| Molecular Formula | C11H15F2N |
| Molecular Weight | 199.24 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 3,3-difluoro-1-(5-methylcyclohexa-1,5-dien-1-yl)pyrrolidine |
| SMILES | CC1=CC(N2CCC(F)(F)C2)=CCC1 |
| InChI | InChI=1S/C11H15F2N/c1-9-3-2-4-10(7-9)14-6-5-11(12,13)8-14/h4,7H,2-3,5-6,8H2,1H3 |
| InChIKey | ICPBJEPZHJBRTP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-difluoro-1-(5-methylcyclohexa-1,5-dien-1-yl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-1-(5-methylcyclohexa-1,5-dien-1-yl)pyrrolidine?
The IUPAC name of 3,3-difluoro-1-(5-methylcyclohexa-1,5-dien-1-yl)pyrrolidine (CID 166838445) is 3,3-difluoro-1-(5-methylcyclohexa-1,5-dien-1-yl)pyrrolidine.
What is the SMILES notation for 3,3-difluoro-1-(5-methylcyclohexa-1,5-dien-1-yl)pyrrolidine?
The canonical SMILES for 3,3-difluoro-1-(5-methylcyclohexa-1,5-dien-1-yl)pyrrolidine is CC1=CC(N2CCC(F)(F)C2)=CCC1.
What is the InChIKey of 3,3-difluoro-1-(5-methylcyclohexa-1,5-dien-1-yl)pyrrolidine?
The InChIKey is ICPBJEPZHJBRTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F2N/c1-9-3-2-4-10(7-9)14-6-5-11(12,13)8-14/h4,7H,2-3,5-6,8H2,1H3.
What are the key properties of 3,3-difluoro-1-(5-methylcyclohexa-1,5-dien-1-yl)pyrrolidine?
3,3-difluoro-1-(5-methylcyclohexa-1,5-dien-1-yl)pyrrolidine has a molecular weight of 199.24 g/mol, XLogP of 2.95, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-1-(5-methylcyclohexa-1,5-dien-1-yl)pyrrolidine is sourced from PubChem (CID 166838445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).