About 4-[(E,4E)-4-(1-fluoroethylidene)hept-2-en-3-yl]morpholine
4-[(E,4E)-4-(1-fluoroethylidene)hept-2-en-3-yl]morpholine (PubChem CID 166838533) has the molecular formula C13H22FNO
and a molecular weight of 227.32 g/mol. Its IUPAC name is 4-[(E,4E)-4-(1-fluoroethylidene)hept-2-en-3-yl]morpholine.
Molecular Properties
| Compound Name | 4-[(E,4E)-4-(1-fluoroethylidene)hept-2-en-3-yl]morpholine |
| PubChem CID | 166838533 |
| Molecular Formula | C13H22FNO |
| Molecular Weight | 227.32 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 4-[(E,4E)-4-(1-fluoroethylidene)hept-2-en-3-yl]morpholine |
| SMILES | C/C=C(C(\CCC)=C(/C)F)/N1CCOCC1 |
| InChI | InChI=1S/C13H22FNO/c1-4-6-12(11(3)14)13(5-2)15-7-9-16-10-8-15/h5H,4,6-10H2,1-3H3/b12-11+,13-5+ |
| InChIKey | LTQSFXHEFSYEDB-KBDPURJKSA-N |
| XLogP | 3.27 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E,4E)-4-(1-fluoroethylidene)hept-2-en-3-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E,4E)-4-(1-fluoroethylidene)hept-2-en-3-yl]morpholine?
The IUPAC name of 4-[(E,4E)-4-(1-fluoroethylidene)hept-2-en-3-yl]morpholine (CID 166838533) is 4-[(E,4E)-4-(1-fluoroethylidene)hept-2-en-3-yl]morpholine.
What is the SMILES notation for 4-[(E,4E)-4-(1-fluoroethylidene)hept-2-en-3-yl]morpholine?
The canonical SMILES for 4-[(E,4E)-4-(1-fluoroethylidene)hept-2-en-3-yl]morpholine is C/C=C(C(\CCC)=C(/C)F)/N1CCOCC1.
What is the InChIKey of 4-[(E,4E)-4-(1-fluoroethylidene)hept-2-en-3-yl]morpholine?
The InChIKey is LTQSFXHEFSYEDB-KBDPURJKSA-N. The full InChI is InChI=1S/C13H22FNO/c1-4-6-12(11(3)14)13(5-2)15-7-9-16-10-8-15/h5H,4,6-10H2,1-3H3/b12-11+,13-5+.
What are the key properties of 4-[(E,4E)-4-(1-fluoroethylidene)hept-2-en-3-yl]morpholine?
4-[(E,4E)-4-(1-fluoroethylidene)hept-2-en-3-yl]morpholine has a molecular weight of 227.32 g/mol, XLogP of 3.27, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E,4E)-4-(1-fluoroethylidene)hept-2-en-3-yl]morpholine is sourced from PubChem (CID 166838533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).