C14H20FNO — CID 166838542
(2E,4Z,6E)-7-fluoro-2,3-dimethyl-1-piperidin-1-ylhepta-2,4,6-trien-1-one (PubChem CID 166838542) has the molecular formula C14H20FNO and a molecular weight of 237.32 g/mol. Its IUPAC name is (2E,4Z,6E)-7-fluoro-2,3-dimethyl-1-piperidin-1-ylhepta-2,4,6-trien-1-one.
| Compound Name | (2E,4Z,6E)-7-fluoro-2,3-dimethyl-1-piperidin-1-ylhepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 166838542 |
| Molecular Formula | C14H20FNO |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | (2E,4Z,6E)-7-fluoro-2,3-dimethyl-1-piperidin-1-ylhepta-2,4,6-trien-1-one |
| SMILES | CC(/C=C\C=C\F)=C(/C)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C14H20FNO/c1-12(8-4-5-9-15)13(2)14(17)16-10-6-3-7-11-16/h4-5,8-9H,3,6-7,10-11H2,1-2H3/b8-4-,9-5+,13-12+ |
| InChIKey | FQJWIKOYSCKXRH-XGNKIHKCSA-N |
| XLogP | 3.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|