C20H20N2 — CID 166838591
(1R,2R)-1,2-bis(4-ethynylphenyl)-N,N'-dimethylethane-1,2-diamine (PubChem CID 166838591) has the molecular formula C20H20N2 and a molecular weight of 288.39 g/mol. Its IUPAC name is (1R,2R)-1,2-bis(4-ethynylphenyl)-N,N'-dimethylethane-1,2-diamine.
| Compound Name | (1R,2R)-1,2-bis(4-ethynylphenyl)-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 166838591 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | (1R,2R)-1,2-bis(4-ethynylphenyl)-N,N'-dimethylethane-1,2-diamine |
| SMILES | C#Cc1ccc([C@@H](NC)[C@H](NC)c2ccc(C#C)cc2)cc1 |
| InChI | InChI=1S/C20H20N2/c1-5-15-7-11-17(12-8-15)19(21-3)20(22-4)18-13-9-16(6-2)10-14-18/h1-2,7-14,19-22H,3-4H3/t19-,20-/m1/s1 |
| InChIKey | VXRLZXVPVJTTOA-WOJBJXKFSA-N |
| XLogP | 2.87 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|