C16H14IN7O2 — CID 166838824
6-[5-[(1S)-1-[(3-iodobenzoyl)amino]ethyl]-1,2,4-triazol-1-yl]pyrimidine-4-carboxamide (PubChem CID 166838824) has the molecular formula C16H14IN7O2 and a molecular weight of 463.24 g/mol. Its IUPAC name is 6-[5-[(1S)-1-[(3-iodobenzoyl)amino]ethyl]-1,2,4-triazol-1-yl]pyrimidine-4-carboxamide.
| Compound Name | 6-[5-[(1S)-1-[(3-iodobenzoyl)amino]ethyl]-1,2,4-triazol-1-yl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 166838824 |
| Molecular Formula | C16H14IN7O2 |
| Molecular Weight | 463.24 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | 6-[5-[(1S)-1-[(3-iodobenzoyl)amino]ethyl]-1,2,4-triazol-1-yl]pyrimidine-4-carboxamide |
| SMILES | C[C@H](NC(=O)c1cccc(I)c1)c1ncnn1-c1cc(C(N)=O)ncn1 |
| InChI | InChI=1S/C16H14IN7O2/c1-9(23-16(26)10-3-2-4-11(17)5-10)15-21-8-22-24(15)13-6-12(14(18)25)19-7-20-13/h2-9H,1H3,(H2,18,25)(H,23,26)/t9-/m0/s1 |
| InChIKey | MECAFPYLGDIVPG-VIFPVBQESA-N |
| XLogP | 1.25 |
| TPSA | 128.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.24 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|