About [2-[[4-(hydroxymethyl)cyclohexyl]methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]methanesulfonyl chloride
[2-[[4-(hydroxymethyl)cyclohexyl]methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]methanesulfonyl chloride (PubChem CID 166838882) has the molecular formula C12H22ClNO5S2
and a molecular weight of 359.90 g/mol. Its IUPAC name is [2-[[4-(hydroxymethyl)cyclohexyl]methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]methanesulfonyl chloride.
Molecular Properties
| Compound Name | [2-[[4-(hydroxymethyl)cyclohexyl]methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]methanesulfonyl chloride |
| PubChem CID | 166838882 |
| Molecular Formula | C12H22ClNO5S2 |
| Molecular Weight | 359.90 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | [2-[[4-(hydroxymethyl)cyclohexyl]methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]methanesulfonyl chloride |
| SMILES | O=S(=O)(Cl)CC1CN(CC2CCC(CO)CC2)S(=O)(=O)C1 |
| InChI | InChI=1S/C12H22ClNO5S2/c13-20(16,17)8-12-6-14(21(18,19)9-12)5-10-1-3-11(7-15)4-2-10/h10-12,15H,1-9H2 |
| InChIKey | SZJFYHLCHUYHAP-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.90 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[[4-(hydroxymethyl)cyclohexyl]methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]methanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[4-(hydroxymethyl)cyclohexyl]methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]methanesulfonyl chloride?
The IUPAC name of [2-[[4-(hydroxymethyl)cyclohexyl]methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]methanesulfonyl chloride (CID 166838882) is [2-[[4-(hydroxymethyl)cyclohexyl]methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]methanesulfonyl chloride.
What is the SMILES notation for [2-[[4-(hydroxymethyl)cyclohexyl]methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]methanesulfonyl chloride?
The canonical SMILES for [2-[[4-(hydroxymethyl)cyclohexyl]methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]methanesulfonyl chloride is O=S(=O)(Cl)CC1CN(CC2CCC(CO)CC2)S(=O)(=O)C1.
What is the InChIKey of [2-[[4-(hydroxymethyl)cyclohexyl]methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]methanesulfonyl chloride?
The InChIKey is SZJFYHLCHUYHAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22ClNO5S2/c13-20(16,17)8-12-6-14(21(18,19)9-12)5-10-1-3-11(7-15)4-2-10/h10-12,15H,1-9H2.
What are the key properties of [2-[[4-(hydroxymethyl)cyclohexyl]methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]methanesulfonyl chloride?
[2-[[4-(hydroxymethyl)cyclohexyl]methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]methanesulfonyl chloride has a molecular weight of 359.90 g/mol, XLogP of 0.62, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[4-(hydroxymethyl)cyclohexyl]methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]methanesulfonyl chloride is sourced from PubChem (CID 166838882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).