About 3-[(4,5-diamino-2-methylpentan-2-yl)oxymethyl]-4-methoxy-2-methylbutan-2-ol
3-[(4,5-diamino-2-methylpentan-2-yl)oxymethyl]-4-methoxy-2-methylbutan-2-ol (PubChem CID 166838904) has the molecular formula C13H30N2O3
and a molecular weight of 262.39 g/mol. Its IUPAC name is 3-[(4,5-diamino-2-methylpentan-2-yl)oxymethyl]-4-methoxy-2-methylbutan-2-ol.
Molecular Properties
| Compound Name | 3-[(4,5-diamino-2-methylpentan-2-yl)oxymethyl]-4-methoxy-2-methylbutan-2-ol |
| PubChem CID | 166838904 |
| Molecular Formula | C13H30N2O3 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 3-[(4,5-diamino-2-methylpentan-2-yl)oxymethyl]-4-methoxy-2-methylbutan-2-ol |
| SMILES | COCC(COC(C)(C)CC(N)CN)C(C)(C)O |
| InChI | InChI=1S/C13H30N2O3/c1-12(2,6-11(15)7-14)18-9-10(8-17-5)13(3,4)16/h10-11,16H,6-9,14-15H2,1-5H3 |
| InChIKey | VUIKIPQOSLSCCO-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(4,5-diamino-2-methylpentan-2-yl)oxymethyl]-4-methoxy-2-methylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,5-diamino-2-methylpentan-2-yl)oxymethyl]-4-methoxy-2-methylbutan-2-ol?
The IUPAC name of 3-[(4,5-diamino-2-methylpentan-2-yl)oxymethyl]-4-methoxy-2-methylbutan-2-ol (CID 166838904) is 3-[(4,5-diamino-2-methylpentan-2-yl)oxymethyl]-4-methoxy-2-methylbutan-2-ol.
What is the SMILES notation for 3-[(4,5-diamino-2-methylpentan-2-yl)oxymethyl]-4-methoxy-2-methylbutan-2-ol?
The canonical SMILES for 3-[(4,5-diamino-2-methylpentan-2-yl)oxymethyl]-4-methoxy-2-methylbutan-2-ol is COCC(COC(C)(C)CC(N)CN)C(C)(C)O.
What is the InChIKey of 3-[(4,5-diamino-2-methylpentan-2-yl)oxymethyl]-4-methoxy-2-methylbutan-2-ol?
The InChIKey is VUIKIPQOSLSCCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30N2O3/c1-12(2,6-11(15)7-14)18-9-10(8-17-5)13(3,4)16/h10-11,16H,6-9,14-15H2,1-5H3.
What are the key properties of 3-[(4,5-diamino-2-methylpentan-2-yl)oxymethyl]-4-methoxy-2-methylbutan-2-ol?
3-[(4,5-diamino-2-methylpentan-2-yl)oxymethyl]-4-methoxy-2-methylbutan-2-ol has a molecular weight of 262.39 g/mol, XLogP of 0.49, 9 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,5-diamino-2-methylpentan-2-yl)oxymethyl]-4-methoxy-2-methylbutan-2-ol is sourced from PubChem (CID 166838904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).