About Ga-MPIX
Ga-MPIX (PubChem CID 16683904) has the molecular formula C34H36GaN4O4
and a molecular weight of 634.41 g/mol.
Molecular Properties
| Compound Name | Ga-MPIX |
| PubChem CID | 16683904 |
| Molecular Formula | C34H36GaN4O4 |
| Molecular Weight | 634.41 g/mol |
| Exact Mass | 633.20 |
| IUPAC Name | — |
| SMILES | CCC1=C(C)/C2=C/c3c(C)c(CCC(=O)O)c4n3[Ga]n3/c(c(C)c(CC)/c3=C/C3=N/C(=C\4)C(CCC(=O)O)=C3C)=C\C1=N2 |
| InChI | InChI=1S/C34H38N4O4.Ga/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;/h13-16H,7-12H2,1-6H3,(H4,35,36,37,38,39,40,41,42);/q;+2/p-2/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16-; |
| InChIKey | KCPNJSJRHBJEJU-RGGAHWMASA-L |
| XLogP | 4.50 |
| TPSA | 109.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 634.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze Ga-MPIX with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ga-MPIX?
The IUPAC name of Ga-MPIX (CID 16683904) is not available.
What is the SMILES notation for Ga-MPIX?
The canonical SMILES for Ga-MPIX is CCC1=C(C)/C2=C/c3c(C)c(CCC(=O)O)c4n3[Ga]n3/c(c(C)c(CC)/c3=C/C3=N/C(=C\4)C(CCC(=O)O)=C3C)=C\C1=N2.
What is the InChIKey of Ga-MPIX?
The InChIKey is KCPNJSJRHBJEJU-RGGAHWMASA-L. The full InChI is InChI=1S/C34H38N4O4.Ga/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;/h13-16H,7-12H2,1-6H3,(H4,35,36,37,38,39,40,41,42);/q;+2/p-2/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16-;.
What are the key properties of Ga-MPIX?
Ga-MPIX has a molecular weight of 634.41 g/mol, XLogP of 4.50, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for Ga-MPIX is sourced from PubChem (CID 16683904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).