About Ga-OEP
Ga-OEP (PubChem CID 16683905) has the molecular formula C37H46GaN4
and a molecular weight of 616.53 g/mol.
Molecular Properties
| Compound Name | Ga-OEP |
| PubChem CID | 16683905 |
| Molecular Formula | C37H46GaN4 |
| Molecular Weight | 616.53 g/mol |
| Exact Mass | 615.30 |
| IUPAC Name | — |
| SMILES | CCCc1c(CC)c2n3c1/C=C1\N=C(/C=c4/c(CC)c(CC)/c(n4[Ga]3)=C/C3=N/C(=C\2)C(CC)=C3CC)C(CC)=C1CC |
| InChI | InChI=1S/C37H46N4.Ga/c1-9-17-29-28(16-8)36-20-34-25(13-5)24(12-4)32(39-34)18-30-22(10-2)23(11-3)31(38-30)19-33-26(14-6)27(15-7)35(40-33)21-37(29)41-36;/h18-21H,9-17H2,1-8H3;/q-2;+2/b30-18-,31-19-,32-18-,33-19-,34-20-,35-21-,36-20-,37-21-; |
| InChIKey | WLUVSMHRWHEMTR-MJYCZNDISA-N |
| XLogP | 7.27 |
| TPSA | 34.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 616.53 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Ga-OEP with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ga-OEP?
The IUPAC name of Ga-OEP (CID 16683905) is not available.
What is the SMILES notation for Ga-OEP?
The canonical SMILES for Ga-OEP is CCCc1c(CC)c2n3c1/C=C1\N=C(/C=c4/c(CC)c(CC)/c(n4[Ga]3)=C/C3=N/C(=C\2)C(CC)=C3CC)C(CC)=C1CC.
What is the InChIKey of Ga-OEP?
The InChIKey is WLUVSMHRWHEMTR-MJYCZNDISA-N. The full InChI is InChI=1S/C37H46N4.Ga/c1-9-17-29-28(16-8)36-20-34-25(13-5)24(12-4)32(39-34)18-30-22(10-2)23(11-3)31(38-30)19-33-26(14-6)27(15-7)35(40-33)21-37(29)41-36;/h18-21H,9-17H2,1-8H3;/q-2;+2/b30-18-,31-19-,32-18-,33-19-,34-20-,35-21-,36-20-,37-21-;.
What are the key properties of Ga-OEP?
Ga-OEP has a molecular weight of 616.53 g/mol, XLogP of 7.27, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Ga-OEP is sourced from PubChem (CID 16683905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).