About N-benzyl-1-(1,3-dimethylimidazol-1-ium-2-yl)ethanimine
N-benzyl-1-(1,3-dimethylimidazol-1-ium-2-yl)ethanimine (PubChem CID 166839762) has the molecular formula C14H18N3+
and a molecular weight of 228.32 g/mol. Its IUPAC name is N-benzyl-1-(1,3-dimethylimidazol-1-ium-2-yl)ethanimine.
Molecular Properties
| Compound Name | N-benzyl-1-(1,3-dimethylimidazol-1-ium-2-yl)ethanimine |
| PubChem CID | 166839762 |
| Molecular Formula | C14H18N3+ |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | N-benzyl-1-(1,3-dimethylimidazol-1-ium-2-yl)ethanimine |
| SMILES | C/C(=N\Cc1ccccc1)c1n(C)cc[n+]1C |
| InChI | InChI=1S/C14H18N3/c1-12(14-16(2)9-10-17(14)3)15-11-13-7-5-4-6-8-13/h4-10H,11H2,1-3H3/q+1/b15-12+ |
| InChIKey | PZIAAGUGTAGDDH-NTCAYCPXSA-N |
| XLogP | 1.86 |
| TPSA | 21.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-1-(1,3-dimethylimidazol-1-ium-2-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-1-(1,3-dimethylimidazol-1-ium-2-yl)ethanimine?
The IUPAC name of N-benzyl-1-(1,3-dimethylimidazol-1-ium-2-yl)ethanimine (CID 166839762) is N-benzyl-1-(1,3-dimethylimidazol-1-ium-2-yl)ethanimine.
What is the SMILES notation for N-benzyl-1-(1,3-dimethylimidazol-1-ium-2-yl)ethanimine?
The canonical SMILES for N-benzyl-1-(1,3-dimethylimidazol-1-ium-2-yl)ethanimine is C/C(=N\Cc1ccccc1)c1n(C)cc[n+]1C.
What is the InChIKey of N-benzyl-1-(1,3-dimethylimidazol-1-ium-2-yl)ethanimine?
The InChIKey is PZIAAGUGTAGDDH-NTCAYCPXSA-N. The full InChI is InChI=1S/C14H18N3/c1-12(14-16(2)9-10-17(14)3)15-11-13-7-5-4-6-8-13/h4-10H,11H2,1-3H3/q+1/b15-12+.
What are the key properties of N-benzyl-1-(1,3-dimethylimidazol-1-ium-2-yl)ethanimine?
N-benzyl-1-(1,3-dimethylimidazol-1-ium-2-yl)ethanimine has a molecular weight of 228.32 g/mol, XLogP of 1.86, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-1-(1,3-dimethylimidazol-1-ium-2-yl)ethanimine is sourced from PubChem (CID 166839762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).