C23H36N3O+ — CID 166839765
methyl 1,3-dimethyl-N-[2-methyl-4-(2,4,4-trimethylhexan-2-yl)phenyl]imidazol-1-ium-2-carboximidate (PubChem CID 166839765) has the molecular formula C23H36N3O+ and a molecular weight of 370.56 g/mol. Its IUPAC name is methyl 1,3-dimethyl-N-[2-methyl-4-(2,4,4-trimethylhexan-2-yl)phenyl]imidazol-1-ium-2-carboximidate.
| Compound Name | methyl 1,3-dimethyl-N-[2-methyl-4-(2,4,4-trimethylhexan-2-yl)phenyl]imidazol-1-ium-2-carboximidate |
|---|---|
| PubChem CID | 166839765 |
| Molecular Formula | C23H36N3O+ |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | methyl 1,3-dimethyl-N-[2-methyl-4-(2,4,4-trimethylhexan-2-yl)phenyl]imidazol-1-ium-2-carboximidate |
| SMILES | CCC(C)(C)CC(C)(C)c1ccc(/N=C(\OC)c2n(C)cc[n+]2C)c(C)c1 |
| InChI | InChI=1S/C23H36N3O/c1-10-22(3,4)16-23(5,6)18-11-12-19(17(2)15-18)24-20(27-9)21-25(7)13-14-26(21)8/h11-15H,10,16H2,1-9H3/q+1/b24-20- |
| InChIKey | CFJJKZLTRRGMKM-GFMRDNFCSA-N |
| XLogP | 4.99 |
| TPSA | 30.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|