C16H14F6N2 — CID 166839779
4-[2-(3-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylaniline (PubChem CID 166839779) has the molecular formula C16H14F6N2 and a molecular weight of 348.29 g/mol. Its IUPAC name is 4-[2-(3-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylaniline.
| Compound Name | 4-[2-(3-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylaniline |
|---|---|
| PubChem CID | 166839779 |
| Molecular Formula | C16H14F6N2 |
| Molecular Weight | 348.29 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 4-[2-(3-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylaniline |
| SMILES | Cc1cc(C(c2cccc(N)c2)(C(F)(F)F)C(F)(F)F)ccc1N |
| InChI | InChI=1S/C16H14F6N2/c1-9-7-11(5-6-13(9)24)14(15(17,18)19,16(20,21)22)10-3-2-4-12(23)8-10/h2-8H,23-24H2,1H3 |
| InChIKey | ZPMKQQROPBGWKK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.29 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|