About 1-ethyl-3-(2,2,2-trifluoroethylamino)pyridin-2-one
1-ethyl-3-(2,2,2-trifluoroethylamino)pyridin-2-one (PubChem CID 166840036) has the molecular formula C9H11F3N2O
and a molecular weight of 220.19 g/mol. Its IUPAC name is 1-ethyl-3-(2,2,2-trifluoroethylamino)pyridin-2-one.
Molecular Properties
| Compound Name | 1-ethyl-3-(2,2,2-trifluoroethylamino)pyridin-2-one |
| PubChem CID | 166840036 |
| Molecular Formula | C9H11F3N2O |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1-ethyl-3-(2,2,2-trifluoroethylamino)pyridin-2-one |
| SMILES | CCn1cccc(NCC(F)(F)F)c1=O |
| InChI | InChI=1S/C9H11F3N2O/c1-2-14-5-3-4-7(8(14)15)13-6-9(10,11)12/h3-5,13H,2,6H2,1H3 |
| InChIKey | QGPCHVKASYMVJZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-3-(2,2,2-trifluoroethylamino)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-(2,2,2-trifluoroethylamino)pyridin-2-one?
The IUPAC name of 1-ethyl-3-(2,2,2-trifluoroethylamino)pyridin-2-one (CID 166840036) is 1-ethyl-3-(2,2,2-trifluoroethylamino)pyridin-2-one.
What is the SMILES notation for 1-ethyl-3-(2,2,2-trifluoroethylamino)pyridin-2-one?
The canonical SMILES for 1-ethyl-3-(2,2,2-trifluoroethylamino)pyridin-2-one is CCn1cccc(NCC(F)(F)F)c1=O.
What is the InChIKey of 1-ethyl-3-(2,2,2-trifluoroethylamino)pyridin-2-one?
The InChIKey is QGPCHVKASYMVJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3N2O/c1-2-14-5-3-4-7(8(14)15)13-6-9(10,11)12/h3-5,13H,2,6H2,1H3.
What are the key properties of 1-ethyl-3-(2,2,2-trifluoroethylamino)pyridin-2-one?
1-ethyl-3-(2,2,2-trifluoroethylamino)pyridin-2-one has a molecular weight of 220.19 g/mol, XLogP of 1.84, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-(2,2,2-trifluoroethylamino)pyridin-2-one is sourced from PubChem (CID 166840036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).