C8H4O6Pb3 — CID 16684029
3,5,7,9-tetraoxa-4λ2,6λ2,8λ2-triplumbabicyclo[9.4.0]pentadeca-1(15),11,13-triene-2,10-dione (PubChem CID 16684029) has the molecular formula C8H4O6Pb3 and a molecular weight of 817.71 g/mol. Its IUPAC name is 3,5,7,9-tetraoxa-4λ2,6λ2,8λ2-triplumbabicyclo[9.4.0]pentadeca-1(15),11,13-triene-2,10-dione.
| Compound Name | 3,5,7,9-tetraoxa-4λ2,6λ2,8λ2-triplumbabicyclo[9.4.0]pentadeca-1(15),11,13-triene-2,10-dione |
|---|---|
| PubChem CID | 16684029 |
| Molecular Formula | C8H4O6Pb3 |
| Molecular Weight | 817.71 g/mol |
| Exact Mass | 819.93 |
| IUPAC Name | 3,5,7,9-tetraoxa-4λ2,6λ2,8λ2-triplumbabicyclo[9.4.0]pentadeca-1(15),11,13-triene-2,10-dione |
| SMILES | O=C1O[Pb]O[Pb]O[Pb]OC(=O)c2ccccc21 |
| InChI | InChI=1S/C8H6O4.2O.3Pb/c9-7(10)5-3-1-2-4-6(5)8(11)12;;;;;/h1-4H,(H,9,10)(H,11,12);;;;;/q;;;;2*+1/p-2 |
| InChIKey | NKQZGKXBBHMXPR-UHFFFAOYSA-L |
| XLogP | -0.35 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.71 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |