About triphenylstannyl 2,2-dimethylpropanoate
triphenylstannyl 2,2-dimethylpropanoate (PubChem CID 16684040) has the molecular formula C23H24O2Sn
and a molecular weight of 451.15 g/mol. Its IUPAC name is triphenylstannyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | triphenylstannyl 2,2-dimethylpropanoate |
| PubChem CID | 16684040 |
| Molecular Formula | C23H24O2Sn |
| Molecular Weight | 451.15 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | triphenylstannyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[Sn](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/3C6H5.C5H10O2.Sn/c3*1-2-4-6-5-3-1;1-5(2,3)4(6)7;/h3*1-5H;1-3H3,(H,6,7);/q;;;;+1/p-1 |
| InChIKey | RQAQGOWWZZZDOG-UHFFFAOYSA-M |
| XLogP | 3.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.15 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze triphenylstannyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenylstannyl 2,2-dimethylpropanoate?
The IUPAC name of triphenylstannyl 2,2-dimethylpropanoate (CID 16684040) is triphenylstannyl 2,2-dimethylpropanoate.
What is the SMILES notation for triphenylstannyl 2,2-dimethylpropanoate?
The canonical SMILES for triphenylstannyl 2,2-dimethylpropanoate is CC(C)(C)C(=O)O[Sn](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of triphenylstannyl 2,2-dimethylpropanoate?
The InChIKey is RQAQGOWWZZZDOG-UHFFFAOYSA-M. The full InChI is InChI=1S/3C6H5.C5H10O2.Sn/c3*1-2-4-6-5-3-1;1-5(2,3)4(6)7;/h3*1-5H;1-3H3,(H,6,7);/q;;;;+1/p-1.
What are the key properties of triphenylstannyl 2,2-dimethylpropanoate?
triphenylstannyl 2,2-dimethylpropanoate has a molecular weight of 451.15 g/mol, XLogP of 3.24, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for triphenylstannyl 2,2-dimethylpropanoate is sourced from PubChem (CID 16684040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).