C12H14N2O2 — CID 166840632
(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.3.2.02,6]dodecane-11-carbonitrile (PubChem CID 166840632) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is (1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.3.2.02,6]dodecane-11-carbonitrile.
| Compound Name | (1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.3.2.02,6]dodecane-11-carbonitrile |
|---|---|
| PubChem CID | 166840632 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.3.2.02,6]dodecane-11-carbonitrile |
| SMILES | N#CC1C[C@@H]2CCC[C@@H]1[C@H]1C(=O)NC(=O)[C@@H]21 |
| InChI | InChI=1S/C12H14N2O2/c13-5-7-4-6-2-1-3-8(7)10-9(6)11(15)14-12(10)16/h6-10H,1-4H2,(H,14,15,16)/t6-,7?,8-,9-,10+/m0/s1 |
| InChIKey | BSANISZYIRLXLU-BOJOCVAMSA-N |
| XLogP | 0.83 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|