C15H23NO — CID 166840794
3-[(1S,4Z,8E)-9-ethoxycyclonona-4,8-dien-2-yn-1-yl]-N-methylpropan-1-amine (PubChem CID 166840794) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 3-[(1S,4Z,8E)-9-ethoxycyclonona-4,8-dien-2-yn-1-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[(1S,4Z,8E)-9-ethoxycyclonona-4,8-dien-2-yn-1-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 166840794 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 3-[(1S,4Z,8E)-9-ethoxycyclonona-4,8-dien-2-yn-1-yl]-N-methylpropan-1-amine |
| SMILES | CCO/C1=C/CC/C=C\C#C[C@@H]1CCCNC |
| InChI | InChI=1S/C15H23NO/c1-3-17-15-12-8-6-4-5-7-10-14(15)11-9-13-16-2/h4-5,12,14,16H,3,6,8-9,11,13H2,1-2H3/b5-4-,15-12+/t14-/m1/s1 |
| InChIKey | WEHNEXXKTKZCFC-VHPOTVKISA-N |
| XLogP | 2.88 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|