2-[[(2-aminohydrazinyl)-fluoromethylidene]amino]acetic acid

C3H7FN4O2 — CID 166840858

IUPAC2-[[(2-aminohydrazinyl)-fluoromethylidene]amino]acetic acid
SMILESNNN/C(F)=N/CC(=O)O
InChIInChI=1S/C3H7FN4O2/c4-3(7-8-5)6-1-2(9)10/h8H,1,5H2,(H,6,7)(H,9,10)
InChIKeyINRZERNOLSNQIW-UHFFFAOYSA-N
MW150.11 g/mol
LogP-1.64
Rot. Bonds3

About 2-[[(2-aminohydrazinyl)-fluoromethylidene]amino]acetic acid

2-[[(2-aminohydrazinyl)-fluoromethylidene]amino]acetic acid (PubChem CID 166840858) has the molecular formula C3H7FN4O2 and a molecular weight of 150.11 g/mol. Its IUPAC name is 2-[[(2-aminohydrazinyl)-fluoromethylidene]amino]acetic acid.

Molecular Properties

Compound Name2-[[(2-aminohydrazinyl)-fluoromethylidene]amino]acetic acid
PubChem CID166840858
Molecular FormulaC3H7FN4O2
Molecular Weight150.11 g/mol
Exact Mass150.06
IUPAC Name2-[[(2-aminohydrazinyl)-fluoromethylidene]amino]acetic acid
SMILESNNN/C(F)=N/CC(=O)O
InChIInChI=1S/C3H7FN4O2/c4-3(7-8-5)6-1-2(9)10/h8H,1,5H2,(H,6,7)(H,9,10)
InChIKeyINRZERNOLSNQIW-UHFFFAOYSA-N
XLogP-1.64
TPSA99.74 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500150.11
LogP ≤ 5-1.64
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-[[(2-aminohydrazinyl)-fluoromethylidene]amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[(2-aminohydrazinyl)-fluoromethylidene]amino]acetic acid?
The IUPAC name of 2-[[(2-aminohydrazinyl)-fluoromethylidene]amino]acetic acid (CID 166840858) is 2-[[(2-aminohydrazinyl)-fluoromethylidene]amino]acetic acid.
What is the SMILES notation for 2-[[(2-aminohydrazinyl)-fluoromethylidene]amino]acetic acid?
The canonical SMILES for 2-[[(2-aminohydrazinyl)-fluoromethylidene]amino]acetic acid is NNN/C(F)=N/CC(=O)O.
What is the InChIKey of 2-[[(2-aminohydrazinyl)-fluoromethylidene]amino]acetic acid?
The InChIKey is INRZERNOLSNQIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7FN4O2/c4-3(7-8-5)6-1-2(9)10/h8H,1,5H2,(H,6,7)(H,9,10).
What are the key properties of 2-[[(2-aminohydrazinyl)-fluoromethylidene]amino]acetic acid?
2-[[(2-aminohydrazinyl)-fluoromethylidene]amino]acetic acid has a molecular weight of 150.11 g/mol, XLogP of -1.64, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2-aminohydrazinyl)-fluoromethylidene]amino]acetic acid is sourced from PubChem (CID 166840858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).