C30H31FN4O2 — CID 166841570
6-(2,1,3-benzoxadiazol-5-yl)-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-2-amine (PubChem CID 166841570) has the molecular formula C30H31FN4O2 and a molecular weight of 498.60 g/mol. Its IUPAC name is 6-(2,1,3-benzoxadiazol-5-yl)-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-2-amine.
| Compound Name | 6-(2,1,3-benzoxadiazol-5-yl)-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-2-amine |
|---|---|
| PubChem CID | 166841570 |
| Molecular Formula | C30H31FN4O2 |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 6-(2,1,3-benzoxadiazol-5-yl)-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-2-amine |
| SMILES | Nc1ccc2c(c1)CCCC(c1ccc3nonc3c1)=C2c1ccc(OC2CCN(CCCF)C2)cc1 |
| InChI | InChI=1S/C30H31FN4O2/c31-14-2-15-35-16-13-25(19-35)36-24-9-5-20(6-10-24)30-26(22-7-12-28-29(18-22)34-37-33-28)4-1-3-21-17-23(32)8-11-27(21)30/h5-12,17-18,25H,1-4,13-16,19,32H2 |
| InChIKey | RNLLVUCFMDGBRL-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|