C7H8ClNS — CID 166842042
7-chloro-2,3,6,7-tetrahydrothieno[2,3-c]pyridine (PubChem CID 166842042) has the molecular formula C7H8ClNS and a molecular weight of 173.67 g/mol. Its IUPAC name is 7-chloro-2,3,6,7-tetrahydrothieno[2,3-c]pyridine.
| Compound Name | 7-chloro-2,3,6,7-tetrahydrothieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 166842042 |
| Molecular Formula | C7H8ClNS |
| Molecular Weight | 173.67 g/mol |
| Exact Mass | 173.01 |
| IUPAC Name | 7-chloro-2,3,6,7-tetrahydrothieno[2,3-c]pyridine |
| SMILES | ClC1NC=CC2=C1SCC2 |
| InChI | InChI=1S/C7H8ClNS/c8-7-6-5(1-3-9-7)2-4-10-6/h1,3,7,9H,2,4H2 |
| InChIKey | MLAMMCISYOEQQL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.67 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|