C16H22N2S — CID 166842063
1-[(2Z,4E)-1-methylsulfanylhepta-2,4-dien-4-yl]-5,6-dihydroindol-5-amine (PubChem CID 166842063) has the molecular formula C16H22N2S and a molecular weight of 274.43 g/mol. Its IUPAC name is 1-[(2Z,4E)-1-methylsulfanylhepta-2,4-dien-4-yl]-5,6-dihydroindol-5-amine.
| Compound Name | 1-[(2Z,4E)-1-methylsulfanylhepta-2,4-dien-4-yl]-5,6-dihydroindol-5-amine |
|---|---|
| PubChem CID | 166842063 |
| Molecular Formula | C16H22N2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 1-[(2Z,4E)-1-methylsulfanylhepta-2,4-dien-4-yl]-5,6-dihydroindol-5-amine |
| SMILES | CC/C=C(\C=C/CSC)n1ccc2c1=CCC(N)C=2 |
| InChI | InChI=1S/C16H22N2S/c1-3-5-15(6-4-11-19-2)18-10-9-13-12-14(17)7-8-16(13)18/h4-6,8-10,12,14H,3,7,11,17H2,1-2H3/b6-4-,15-5+ |
| InChIKey | VCXUZTPTZIPZHX-KJQUZEEOSA-N |
| XLogP | 1.95 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|