C16H4F6N4 — CID 166842101
2-[6-(dicyanomethylidene)-1,3,4,5,7,8-hexafluoro-4a,5-dihydro-2H-naphthalen-2-yl]propanedinitrile (PubChem CID 166842101) has the molecular formula C16H4F6N4 and a molecular weight of 366.22 g/mol. Its IUPAC name is 2-[6-(dicyanomethylidene)-1,3,4,5,7,8-hexafluoro-4a,5-dihydro-2H-naphthalen-2-yl]propanedinitrile.
| Compound Name | 2-[6-(dicyanomethylidene)-1,3,4,5,7,8-hexafluoro-4a,5-dihydro-2H-naphthalen-2-yl]propanedinitrile |
|---|---|
| PubChem CID | 166842101 |
| Molecular Formula | C16H4F6N4 |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 2-[6-(dicyanomethylidene)-1,3,4,5,7,8-hexafluoro-4a,5-dihydro-2H-naphthalen-2-yl]propanedinitrile |
| SMILES | N#CC(C#N)=C1C(F)=C(F)C2=C(F)C(C(C#N)C#N)C(F)=C(F)C2C1F |
| InChI | InChI=1S/C16H4F6N4/c17-11-7(5(1-23)2-24)13(19)15(21)10-9(11)16(22)14(20)8(12(10)18)6(3-25)4-26/h5,7,10,12H |
| InChIKey | MFMOKFXDOLQPQQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|