C12H21NO2S — CID 166842117
(3Z,5Z)-4-propan-2-ylnona-1,3,5-triene-2-sulfonamide (PubChem CID 166842117) has the molecular formula C12H21NO2S and a molecular weight of 243.37 g/mol. Its IUPAC name is (3Z,5Z)-4-propan-2-ylnona-1,3,5-triene-2-sulfonamide.
| Compound Name | (3Z,5Z)-4-propan-2-ylnona-1,3,5-triene-2-sulfonamide |
|---|---|
| PubChem CID | 166842117 |
| Molecular Formula | C12H21NO2S |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | (3Z,5Z)-4-propan-2-ylnona-1,3,5-triene-2-sulfonamide |
| SMILES | C=C(/C=C(\C=C/CCC)C(C)C)S(N)(=O)=O |
| InChI | InChI=1S/C12H21NO2S/c1-5-6-7-8-12(10(2)3)9-11(4)16(13,14)15/h7-10H,4-6H2,1-3H3,(H2,13,14,15)/b8-7-,12-9+ |
| InChIKey | VSNBWSXYOJRBRZ-HVTAIUIQSA-N |
| XLogP | 2.73 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|