C22H21FN6OS — CID 166843365
N-[(3R)-1-cyano-2,4-dimethylpyrrolidin-3-yl]-3-[4-(4-fluorophenyl)sulfanyl-3-pyridinyl]-1H-pyrazole-5-carboxamide (PubChem CID 166843365) has the molecular formula C22H21FN6OS and a molecular weight of 436.52 g/mol. Its IUPAC name is N-[(3R)-1-cyano-2,4-dimethylpyrrolidin-3-yl]-3-[4-(4-fluorophenyl)sulfanyl-3-pyridinyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(3R)-1-cyano-2,4-dimethylpyrrolidin-3-yl]-3-[4-(4-fluorophenyl)sulfanyl-3-pyridinyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 166843365 |
| Molecular Formula | C22H21FN6OS |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | N-[(3R)-1-cyano-2,4-dimethylpyrrolidin-3-yl]-3-[4-(4-fluorophenyl)sulfanyl-3-pyridinyl]-1H-pyrazole-5-carboxamide |
| SMILES | CC1CN(C#N)C(C)[C@@H]1NC(=O)c1cc(-c2cnccc2Sc2ccc(F)cc2)n[nH]1 |
| InChI | InChI=1S/C22H21FN6OS/c1-13-11-29(12-24)14(2)21(13)26-22(30)19-9-18(27-28-19)17-10-25-8-7-20(17)31-16-5-3-15(23)4-6-16/h3-10,13-14,21H,11H2,1-2H3,(H,26,30)(H,27,28)/t13?,14?,21-/m1/s1 |
| InChIKey | IBQBRLJDCBWFBR-OCJVHDGVSA-N |
| XLogP | 3.68 |
| TPSA | 97.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|