C22H18N4O2S — CID 166843414
(5R)-4-methyl-6-[5-(2-phenoxyphenyl)-1,3-thiazole-2-carbonyl]-2,6-diazabicyclo[3.1.0]hexane-2-carbonitrile (PubChem CID 166843414) has the molecular formula C22H18N4O2S and a molecular weight of 402.48 g/mol. Its IUPAC name is (5R)-4-methyl-6-[5-(2-phenoxyphenyl)-1,3-thiazole-2-carbonyl]-2,6-diazabicyclo[3.1.0]hexane-2-carbonitrile.
| Compound Name | (5R)-4-methyl-6-[5-(2-phenoxyphenyl)-1,3-thiazole-2-carbonyl]-2,6-diazabicyclo[3.1.0]hexane-2-carbonitrile |
|---|---|
| PubChem CID | 166843414 |
| Molecular Formula | C22H18N4O2S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | (5R)-4-methyl-6-[5-(2-phenoxyphenyl)-1,3-thiazole-2-carbonyl]-2,6-diazabicyclo[3.1.0]hexane-2-carbonitrile |
| SMILES | CC1CN(C#N)C2[C@@H]1N2C(=O)c1ncc(-c2ccccc2Oc2ccccc2)s1 |
| InChI | InChI=1S/C22H18N4O2S/c1-14-12-25(13-23)21-19(14)26(21)22(27)20-24-11-18(29-20)16-9-5-6-10-17(16)28-15-7-3-2-4-8-15/h2-11,14,19,21H,12H2,1H3/t14?,19-,21?,26?/m1/s1 |
| InChIKey | LXHWXLGRLCHBPR-JAURKTSWSA-N |
| XLogP | 4.19 |
| TPSA | 69.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|