About triphenylstannyl methanesulfonate
triphenylstannyl methanesulfonate (PubChem CID 16684369) has the molecular formula C19H18O3SSn
and a molecular weight of 445.13 g/mol. Its IUPAC name is triphenylstannyl methanesulfonate.
Molecular Properties
| Compound Name | triphenylstannyl methanesulfonate |
| PubChem CID | 16684369 |
| Molecular Formula | C19H18O3SSn |
| Molecular Weight | 445.13 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | triphenylstannyl methanesulfonate |
| SMILES | CS(=O)(=O)O[Sn](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/3C6H5.CH4O3S.Sn/c3*1-2-4-6-5-3-1;1-5(2,3)4;/h3*1-5H;1H3,(H,2,3,4);/q;;;;+1/p-1 |
| InChIKey | BLYMWGUXSHVEDI-UHFFFAOYSA-M |
| XLogP | 1.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.13 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze triphenylstannyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenylstannyl methanesulfonate?
The IUPAC name of triphenylstannyl methanesulfonate (CID 16684369) is triphenylstannyl methanesulfonate.
What is the SMILES notation for triphenylstannyl methanesulfonate?
The canonical SMILES for triphenylstannyl methanesulfonate is CS(=O)(=O)O[Sn](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of triphenylstannyl methanesulfonate?
The InChIKey is BLYMWGUXSHVEDI-UHFFFAOYSA-M. The full InChI is InChI=1S/3C6H5.CH4O3S.Sn/c3*1-2-4-6-5-3-1;1-5(2,3)4;/h3*1-5H;1H3,(H,2,3,4);/q;;;;+1/p-1.
What are the key properties of triphenylstannyl methanesulfonate?
triphenylstannyl methanesulfonate has a molecular weight of 445.13 g/mol, XLogP of 1.63, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triphenylstannyl methanesulfonate is sourced from PubChem (CID 16684369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).