About 2-methoxy-3-(1,3,4-thiadiazol-2-yl)aniline
2-methoxy-3-(1,3,4-thiadiazol-2-yl)aniline (PubChem CID 166843941) has the molecular formula C9H9N3OS
and a molecular weight of 207.26 g/mol. Its IUPAC name is 2-methoxy-3-(1,3,4-thiadiazol-2-yl)aniline.
Molecular Properties
| Compound Name | 2-methoxy-3-(1,3,4-thiadiazol-2-yl)aniline |
| PubChem CID | 166843941 |
| Molecular Formula | C9H9N3OS |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 2-methoxy-3-(1,3,4-thiadiazol-2-yl)aniline |
| SMILES | COc1c(N)cccc1-c1nncs1 |
| InChI | InChI=1S/C9H9N3OS/c1-13-8-6(3-2-4-7(8)10)9-12-11-5-14-9/h2-5H,10H2,1H3 |
| InChIKey | RMYGIEMTBZSKTK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-3-(1,3,4-thiadiazol-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-3-(1,3,4-thiadiazol-2-yl)aniline?
The IUPAC name of 2-methoxy-3-(1,3,4-thiadiazol-2-yl)aniline (CID 166843941) is 2-methoxy-3-(1,3,4-thiadiazol-2-yl)aniline.
What is the SMILES notation for 2-methoxy-3-(1,3,4-thiadiazol-2-yl)aniline?
The canonical SMILES for 2-methoxy-3-(1,3,4-thiadiazol-2-yl)aniline is COc1c(N)cccc1-c1nncs1.
What is the InChIKey of 2-methoxy-3-(1,3,4-thiadiazol-2-yl)aniline?
The InChIKey is RMYGIEMTBZSKTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3OS/c1-13-8-6(3-2-4-7(8)10)9-12-11-5-14-9/h2-5H,10H2,1H3.
What are the key properties of 2-methoxy-3-(1,3,4-thiadiazol-2-yl)aniline?
2-methoxy-3-(1,3,4-thiadiazol-2-yl)aniline has a molecular weight of 207.26 g/mol, XLogP of 1.80, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-3-(1,3,4-thiadiazol-2-yl)aniline is sourced from PubChem (CID 166843941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).